Product Description
Isophorone Diisocyanate (IPDI) is a premium aliphatic isocyanate monomer. Benefiting from its unique cyclic molecular structure, it exhibits stable chemical reactivity, outstanding weather resistance and low yellowing tendency, widely adopted for manufacturing high-end polyurethane functional materials.
Product Parameters
| Melting point | -60°C |
| Boiling point | 158-159 °C15 mm Hg(lit.) |
| density | 1.049 g/mL at 25 °C(lit.) |
| vapor pressure | 0.0004 hPa (20 °C) |
| refractive index | n20/D 1.484(lit.) |
| Fp | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with esters, ketones, ethers, and aromatic and aliphatic hydrocarbons. |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| explosive limit | 0.7-4.5%(V) |
| Water Solubility | <0.1 g/100 mL at 25 ºC |
| Sensitive | Moisture Sensitive |
| BRN | 2726467 |
| Exposure limits | TLV-TWA 0.0454 mg/m3 (0.005 ppm) (ACGIH and NIOSH); ceiling 0.181 mg/m3 (0.02 ppm)/10 min (NIOSH). . |
| Stability: | Reacts with all substances containing active hydrogen, such as acids, amines, water, phenols, mercaptans, amides, urea. Probably moisture sensitive. |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/C12H18N2O2/c1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15/h10H,4-7H2,1-3H3 |
| InChIKey | NIMLQBUJDJZYEJ-UHFFFAOYSA-N |
| SMILES | N(=C=O)C1CC(CC(C1)(C)C)(CN=C=O)C |
| LogP | 4.75 at 25℃ |
| CAS DataBase Reference | 4098-71-9(CAS DataBase Reference) |
| EPA Substance Registry System | Isophorone diisocyanate (4098-71-9) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 23-36/37/38-42/43-51/53-22 |
| Safety Statements | 26-28-38-45-61 |
| OEB | D |
| OEL | TWA: 0.005 ppm (0.045 mg/m3), STEL: 0.02 ppm (0.180 mg/m3) [skin] |
| RIDADR | UN 2290 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | NQ9370000 |
| Autoignition Temperature | 430 °C |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29291090 |
Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 |
| very toxic hazardous materials | |
Hazard Classifications | Acute Tox. 1 Inhalation |
| Aquatic Chronic 2 | |
| Eye Irrit. 2 | |
| Resp. Sens. 1 | |
| Skin Irrit. 2 | |
| Skin Sens. 1 | |
| STOT SE 3 | |
| Hazardous Substances Data | 4098-71-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 4825 mg/kg LD50 dermal Rat > 7000 mg/kg |
Application Scenarios
IPDI is primarily used to synthesize high-performance polyurethane resins with exceptional light stability, chemical resistance and anti-aging properties. It significantly improves coating hardness, flexibility, abrasion resistance and weatherability, widely used in advanced paints, varnishes and industrial finish systems.
Additionally, it serves as a core raw material for high-elasticity elastomers, casting compounds, sealants and flexible textile coatings. It also acts as a professional curing agent for polyurethane systems and a special material intermediate for medical contact lens production, covering industrial coating, new material and high-precision manufacturing fields.
